C14H16N2O5S — CID 7174419
2-(3-ethyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)sulfanylacetic acid (PubChem CID 7174419) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-(3-ethyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)sulfanylacetic acid.
| Compound Name | 2-(3-ethyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 7174419 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-(3-ethyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)sulfanylacetic acid |
| SMILES | CCn1c(SCC(=O)O)nc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C14H16N2O5S/c1-4-16-13(19)8-5-10(20-2)11(21-3)6-9(8)15-14(16)22-7-12(17)18/h5-6H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | DVAZUXXIPNYLAJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |