C13H12N2O5S — CID 14721779
2-[3-(2-methoxy-2-oxoethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid (PubChem CID 14721779) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-[3-(2-methoxy-2-oxoethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-(2-methoxy-2-oxoethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 14721779 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[3-(2-methoxy-2-oxoethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid |
| SMILES | COC(=O)Cn1c(SCC(=O)O)nc2ccccc2c1=O |
| InChI | InChI=1S/C13H12N2O5S/c1-20-11(18)6-15-12(19)8-4-2-3-5-9(8)14-13(15)21-7-10(16)17/h2-5H,6-7H2,1H3,(H,16,17) |
| InChIKey | QOZSAOOTNISMHB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |