C19H15ClN2O4S — CID 8868469
methyl 2-[2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate (PubChem CID 8868469) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate.
| Compound Name | methyl 2-[2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 8868469 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | methyl 2-[2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate |
| SMILES | COC(=O)Cn1c(SCC(=O)c2ccc(Cl)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H15ClN2O4S/c1-26-17(24)10-22-18(25)14-4-2-3-5-15(14)21-19(22)27-11-16(23)12-6-8-13(20)9-7-12/h2-9H,10-11H2,1H3 |
| InChIKey | ITIOYQSTCKOZHG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |