C19H16N2O6S — CID 7647566
methyl 2-[2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate (PubChem CID 7647566) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is methyl 2-[2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate.
| Compound Name | methyl 2-[2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 7647566 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | methyl 2-[2-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]acetate |
| SMILES | COC(=O)Cn1c(SCC(=O)c2ccc(O)c(O)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H16N2O6S/c1-27-17(25)9-21-18(26)12-4-2-3-5-13(12)20-19(21)28-10-16(24)11-6-7-14(22)15(23)8-11/h2-8,22-23H,9-10H2,1H3 |
| InChIKey | GOFKHIGYWDXXFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|