C20H19ClN2O2S — CID 2529545
3-[(2S)-butan-2-yl]-2-[2-(3-chlorophenyl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 2529545) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-2-[2-(3-chlorophenyl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-[(2S)-butan-2-yl]-2-[2-(3-chlorophenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2529545 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-2-[2-(3-chlorophenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CC[C@H](C)n1c(SCC(=O)c2cccc(Cl)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H19ClN2O2S/c1-3-13(2)23-19(25)16-9-4-5-10-17(16)22-20(23)26-12-18(24)14-7-6-8-15(21)11-14/h4-11,13H,3,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | MNROWUAARNVJPP-ZDUSSCGKSA-N |
| XLogP | 5.00 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |