C20H21N5O2S — CID 18275768
3-[[2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide (PubChem CID 18275768) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-[[2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 18275768 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-[[2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide |
| SMILES | CCNc1nc(SCC(=O)Nc2cccc(C(=O)NC)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H21N5O2S/c1-3-22-18-15-9-4-5-10-16(15)24-20(25-18)28-12-17(26)23-14-8-6-7-13(11-14)19(27)21-2/h4-11H,3,12H2,1-2H3,(H,21,27)(H,23,26)(H,22,24,25) |
| InChIKey | AMWYBMZPSLJYSK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |