C24H24N4O3S — CID 44821164
3-[[2-[4-(2-bicyclo[2.2.1]heptanylamino)quinazolin-2-yl]sulfanylacetyl]amino]benzoic acid (PubChem CID 44821164) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-[[2-[4-(2-bicyclo[2.2.1]heptanylamino)quinazolin-2-yl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-(2-bicyclo[2.2.1]heptanylamino)quinazolin-2-yl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 44821164 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[[2-[4-(2-bicyclo[2.2.1]heptanylamino)quinazolin-2-yl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1nc(NC2CC3CCC2C3)c2ccccc2n1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H24N4O3S/c29-21(25-17-5-3-4-16(12-17)23(30)31)13-32-24-27-19-7-2-1-6-18(19)22(28-24)26-20-11-14-8-9-15(20)10-14/h1-7,12,14-15,20H,8-11,13H2,(H,25,29)(H,30,31)(H,26,27,28) |
| InChIKey | LEFKBRQCMWDLFJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |