C19H15NO3S — CID 45425864
3-[(2-naphthalen-2-ylsulfanylacetyl)amino]benzoic acid (PubChem CID 45425864) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-[(2-naphthalen-2-ylsulfanylacetyl)amino]benzoic acid.
| Compound Name | 3-[(2-naphthalen-2-ylsulfanylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 45425864 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[(2-naphthalen-2-ylsulfanylacetyl)amino]benzoic acid |
| SMILES | O=C(CSc1ccc2ccccc2c1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H15NO3S/c21-18(20-16-7-3-6-15(10-16)19(22)23)12-24-17-9-8-13-4-1-2-5-14(13)11-17/h1-11H,12H2,(H,20,21)(H,22,23) |
| InChIKey | XFMWVZJAVDNEJL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |