C18H13F2NOS — CID 7736930
2-(3,4-difluorophenyl)sulfanyl-N-naphthalen-2-ylacetamide (PubChem CID 7736930) has the molecular formula C18H13F2NOS and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 7736930 |
| Molecular Formula | C18H13F2NOS |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CSc1ccc(F)c(F)c1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H13F2NOS/c19-16-8-7-15(10-17(16)20)23-11-18(22)21-14-6-5-12-3-1-2-4-13(12)9-14/h1-10H,11H2,(H,21,22) |
| InChIKey | DDNZAIPKQVBJPC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |