C14H10ClF2NOS — CID 9055593
N-(3-chlorophenyl)-2-(3,4-difluorophenyl)sulfanylacetamide (PubChem CID 9055593) has the molecular formula C14H10ClF2NOS and a molecular weight of 313.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(3,4-difluorophenyl)sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-(3,4-difluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 9055593 |
| Molecular Formula | C14H10ClF2NOS |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-(3-chlorophenyl)-2-(3,4-difluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(F)c(F)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2NOS/c15-9-2-1-3-10(6-9)18-14(19)8-20-11-4-5-12(16)13(17)7-11/h1-7H,8H2,(H,18,19) |
| InChIKey | QLQIDRJFHHNMBB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |