C14H7ClF5NOS — CID 7467403
N-(3-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide (PubChem CID 7467403) has the molecular formula C14H7ClF5NOS and a molecular weight of 367.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7467403 |
| Molecular Formula | C14H7ClF5NOS |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(F)c(F)c(F)c(F)c1F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H7ClF5NOS/c15-6-2-1-3-7(4-6)21-8(22)5-23-14-12(19)10(17)9(16)11(18)13(14)20/h1-4H,5H2,(H,21,22) |
| InChIKey | VNTGRPFNLXGBIJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|