C18H16N2O3S2 — CID 2225782
2-naphthalen-2-ylsulfanyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2225782) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-naphthalen-2-ylsulfanyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-naphthalen-2-ylsulfanyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2225782 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-naphthalen-2-ylsulfanyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C18H16N2O3S2/c19-25(22,23)17-9-6-15(7-10-17)20-18(21)12-24-16-8-5-13-3-1-2-4-14(13)11-16/h1-11H,12H2,(H,20,21)(H2,19,22,23) |
| InChIKey | CLGIEBAJPWNQPJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |