C19H22N4O4 — CID 9294111
3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide (PubChem CID 9294111) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 9294111 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(NC(=O)CCc2c(C)noc2C)C1=O |
| InChI | InChI=1S/C19H22N4O4/c1-4-19(14-8-6-5-7-9-14)17(25)23(18(26)20-19)21-16(24)11-10-15-12(2)22-27-13(15)3/h5-9H,4,10-11H2,1-3H3,(H,20,26)(H,21,24)/t19-/m1/s1 |
| InChIKey | LWGKJOHGGJXHMC-LJQANCHMSA-N |
| XLogP | 2.11 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|