C23H24N6O3S — CID 24549169
N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 24549169) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 24549169 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(NC(=O)CCn2c(-c3ccc(C)cc3)n[nH]c2=S)C1=O |
| InChI | InChI=1S/C23H24N6O3S/c1-3-23(17-7-5-4-6-8-17)20(31)29(21(32)24-23)27-18(30)13-14-28-19(25-26-22(28)33)16-11-9-15(2)10-12-16/h4-12H,3,13-14H2,1-2H3,(H,24,32)(H,26,33)(H,27,30) |
| InChIKey | SELJBJAAOJHFBN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|