C19H23N4O4+ — CID 8922679
[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8922679) has the molecular formula C19H23N4O4+ and a molecular weight of 371.42 g/mol. Its IUPAC name is [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8922679 |
| Molecular Formula | C19H23N4O4+ |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(NC(=O)C[NH2+][C@H](C)c2ccco2)C1=O |
| InChI | InChI=1S/C19H22N4O4/c1-3-19(14-8-5-4-6-9-14)17(25)23(18(26)21-19)22-16(24)12-20-13(2)15-10-7-11-27-15/h4-11,13,20H,3,12H2,1-2H3,(H,21,26)(H,22,24)/p+1/t13-,19-/m1/s1 |
| InChIKey | MUMFBVDPUIRNOZ-BFUOFWGJSA-O |
| XLogP | 0.79 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|