C20H22ClN4O3+ — CID 8598409
[(1R)-1-(2-chlorophenyl)ethyl]-[2-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium (PubChem CID 8598409) has the molecular formula C20H22ClN4O3+ and a molecular weight of 401.87 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl]-[2-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8598409 |
| Molecular Formula | C20H22ClN4O3+ |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NN1C(=O)N[C@@](C)(c2ccccc2)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H21ClN4O3/c1-13(15-10-6-7-11-16(15)21)22-12-17(26)24-25-18(27)20(2,23-19(25)28)14-8-4-3-5-9-14/h3-11,13,22H,12H2,1-2H3,(H,23,28)(H,24,26)/p+1/t13-,20+/m1/s1 |
| InChIKey | GNWUGIZRUDTYRV-XCLFUZPHSA-O |
| XLogP | 1.46 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|