C15H20N3O2+ — CID 8555130
N'-acetyl-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetohydrazide (PubChem CID 8555130) has the molecular formula C15H20N3O2+ and a molecular weight of 274.34 g/mol. Its IUPAC name is N'-acetyl-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetohydrazide.
| Compound Name | N'-acetyl-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 8555130 |
| Molecular Formula | C15H20N3O2+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N'-acetyl-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetohydrazide |
| SMILES | CC(=O)NNC(=O)C[NH+]1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H19N3O2/c1-12(19)16-17-15(20)11-18-9-7-14(8-10-18)13-5-3-2-4-6-13/h2-7H,8-11H2,1H3,(H,16,19)(H,17,20)/p+1 |
| InChIKey | YQKIUAXUODTMLA-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|