C19H18F3N2O+ — CID 2117129
2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2117129) has the molecular formula C19H18F3N2O+ and a molecular weight of 347.36 g/mol. Its IUPAC name is 2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2117129 |
| Molecular Formula | C19H18F3N2O+ |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CC=C(c2ccccc2)CC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H17F3N2O/c20-15-6-7-16(19(22)18(15)21)23-17(25)12-24-10-8-14(9-11-24)13-4-2-1-3-5-13/h1-8H,9-12H2,(H,23,25)/p+1 |
| InChIKey | HCUYCOFETTUEMB-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|