C20H22N3O2+ — CID 8758997
N'-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]benzohydrazide (PubChem CID 8758997) has the molecular formula C20H22N3O2+ and a molecular weight of 336.42 g/mol. Its IUPAC name is N'-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]benzohydrazide.
| Compound Name | N'-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8758997 |
| Molecular Formula | C20H22N3O2+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N'-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(C[NH+]1CC=C(c2ccccc2)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c24-19(21-22-20(25)18-9-5-2-6-10-18)15-23-13-11-17(12-14-23)16-7-3-1-4-8-16/h1-11H,12-15H2,(H,21,24)(H,22,25)/p+1 |
| InChIKey | IDGOXBZZRXVYDC-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|