C16H24N3O2+ — CID 8904662
N'-[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 8904662) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is N'-[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8904662 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | N'-[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | C[C@@H]1C[C@@H](C)C[NH+](CC(=O)NNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-12-8-13(2)10-19(9-12)11-15(20)17-18-16(21)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,17,20)(H,18,21)/p+1/t12-,13-/m1/s1 |
| InChIKey | ORQUUFHORXPHOS-CHWSQXEVSA-O |
| XLogP | 0.01 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|