C15H22IN2O+ — CID 8930854
2-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-(2-iodophenyl)acetamide (PubChem CID 8930854) has the molecular formula C15H22IN2O+ and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 8930854 |
| Molecular Formula | C15H22IN2O+ |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-(2-iodophenyl)acetamide |
| SMILES | C[C@@H]1C[C@H](C)C[NH+](CC(=O)Nc2ccccc2I)C1 |
| InChI | InChI=1S/C15H21IN2O/c1-11-7-12(2)9-18(8-11)10-15(19)17-14-6-4-3-5-13(14)16/h3-6,11-12H,7-10H2,1-2H3,(H,17,19)/p+1/t11-,12+ |
| InChIKey | GNLRCRWMPMKLOX-TXEJJXNPSA-O |
| XLogP | 1.79 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|