C22H29N2O+ — CID 7406184
N-benzhydryl-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide (PubChem CID 7406184) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is N-benzhydryl-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-benzhydryl-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7406184 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-benzhydryl-2-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CC(=O)NC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H28N2O/c1-17-13-18(2)15-24(14-17)16-21(25)23-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,22H,13-16H2,1-2H3,(H,23,25)/p+1/t17-,18-/m0/s1 |
| InChIKey | QWLCZUXANZYZJJ-ROUUACIJSA-O |
| XLogP | 2.45 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |