C16H25N2O+ — CID 7460108
3-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-phenylpropanamide (PubChem CID 7460108) has the molecular formula C16H25N2O+ and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 7460108 |
| Molecular Formula | C16H25N2O+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-phenylpropanamide |
| SMILES | C[C@@H]1C[C@H](C)C[NH+](CCC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2O/c1-13-10-14(2)12-18(11-13)9-8-16(19)17-15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3,(H,17,19)/p+1/t13-,14+ |
| InChIKey | CFMUYKXNSHGRPL-OKILXGFUSA-O |
| XLogP | 1.58 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |