C23H36N4O2+2 — CID 8754222
N-butyl-2-[4-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8754222) has the molecular formula C23H36N4O2+2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-butyl-2-[4-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8754222 |
| Molecular Formula | C23H36N4O2+2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | N-butyl-2-[4-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)C[NH+]1CCN(C(=O)C[NH+]2CC=C(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H34N4O2/c1-2-3-11-24-22(28)18-26-14-16-27(17-15-26)23(29)19-25-12-9-21(10-13-25)20-7-5-4-6-8-20/h4-9H,2-3,10-19H2,1H3,(H,24,28)/p+2 |
| InChIKey | PORKDQJIUAIWEV-UHFFFAOYSA-P |
| XLogP | -1.00 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|