C18H30N3O+ — CID 8582982
N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8582982) has the molecular formula C18H30N3O+ and a molecular weight of 304.46 g/mol. Its IUPAC name is N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8582982 |
| Molecular Formula | C18H30N3O+ |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-butyl-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)C[NH+]1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-4-5-9-19-18(22)14-20-10-12-21(13-11-20)17-8-6-7-15(2)16(17)3/h6-8H,4-5,9-14H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | HLAISFSAJUUDKG-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|