C23H35N4O2+ — CID 8582796
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8582796) has the molecular formula C23H35N4O2+ and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8582796 |
| Molecular Formula | C23H35N4O2+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(N2CC[NH+](CC(=O)NC(=O)NCCC3=CCCCC3)CC2)c1C |
| InChI | InChI=1S/C23H34N4O2/c1-18-7-6-10-21(19(18)2)27-15-13-26(14-16-27)17-22(28)25-23(29)24-12-11-20-8-4-3-5-9-20/h6-8,10H,3-5,9,11-17H2,1-2H3,(H2,24,25,28,29)/p+1 |
| InChIKey | PCVPSXOKGDKJGD-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|