C17H24N2O — CID 4995212
1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-dimethylphenyl)urea (PubChem CID 4995212) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 4995212 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-13-7-6-8-14(2)16(13)19-17(20)18-12-11-15-9-4-3-5-10-15/h6-9H,3-5,10-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | UWSAVXHZFKYXPS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|