C23H27N3O2 — CID 109103351
3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(2,6-dimethylphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109103351) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(2,6-dimethylphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(2,6-dimethylphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103351 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(2,6-dimethylphenyl)pyridine-3,5-dicarboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cncc(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-7-6-8-17(2)21(16)26-23(28)20-13-19(14-24-15-20)22(27)25-12-11-18-9-4-3-5-10-18/h6-9,13-15H,3-5,10-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CCOZVWUSYHHZAB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|