C17H27N4O2+ — CID 8725268
2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(propylcarbamoyl)acetamide (PubChem CID 8725268) has the molecular formula C17H27N4O2+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8725268 |
| Molecular Formula | C17H27N4O2+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)C[NH+]1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C17H26N4O2/c1-3-8-18-17(23)19-16(22)13-20-9-11-21(12-10-20)15-7-5-4-6-14(15)2/h4-7H,3,8-13H2,1-2H3,(H2,18,19,22,23)/p+1 |
| InChIKey | DVKLMASDOVRORT-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |