C16H27N5O2+2 — CID 8619861
N-(butylcarbamoyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8619861) has the molecular formula C16H27N5O2+2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(butylcarbamoyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8619861 |
| Molecular Formula | C16H27N5O2+2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-(butylcarbamoyl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)C[NH+]1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C16H25N5O2/c1-2-3-7-18-16(23)19-15(22)13-20-9-11-21(12-10-20)14-6-4-5-8-17-14/h4-6,8H,2-3,7,9-13H2,1H3,(H2,18,19,22,23)/p+2 |
| InChIKey | AFCKRVXFMIEAAQ-UHFFFAOYSA-P |
| XLogP | -1.17 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|