C19H24ClN5O3+2 — CID 8548671
N'-[2-(4-chlorophenoxy)acetyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetohydrazide (PubChem CID 8548671) has the molecular formula C19H24ClN5O3+2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N'-[2-(4-chlorophenoxy)acetyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetohydrazide.
| Compound Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 8548671 |
| Molecular Formula | C19H24ClN5O3+2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNC(=O)C[NH+]1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C19H22ClN5O3/c20-15-4-6-16(7-5-15)28-14-19(27)23-22-18(26)13-24-9-11-25(12-10-24)17-3-1-2-8-21-17/h1-8H,9-14H2,(H,22,26)(H,23,27)/p+2 |
| InChIKey | OFNTYNCBZSCWPZ-UHFFFAOYSA-P |
| XLogP | -0.91 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|