C19H25ClN4O+2 — CID 8546566
N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8546566) has the molecular formula C19H25ClN4O+2 and a molecular weight of 360.89 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8546566 |
| Molecular Formula | C19H25ClN4O+2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CCN(c2cccc[nH+]2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN4O/c1-15(16-5-4-6-17(20)13-16)22-19(25)14-23-9-11-24(12-10-23)18-7-2-3-8-21-18/h2-8,13,15H,9-12,14H2,1H3,(H,22,25)/p+2/t15-/m1/s1 |
| InChIKey | PCGNPFPBNFOHOM-OAHLLOKOSA-P |
| XLogP | 0.74 |
| TPSA | 50.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |