C21H29N4O3S+ — CID 8726538
2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 8726538) has the molecular formula C21H29N4O3S+ and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8726538 |
| Molecular Formula | C21H29N4O3S+ |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1N1CC[NH+](CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C21H28N4O3S/c1-17-4-2-3-5-20(17)25-14-12-24(13-15-25)16-21(26)23-11-10-18-6-8-19(9-7-18)29(22,27)28/h2-9H,10-16H2,1H3,(H,23,26)(H2,22,27,28)/p+1 |
| InChIKey | VNEDTVPRKCVMBZ-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |