C22H34N3O2+ — CID 8703770
N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8703770) has the molecular formula C22H34N3O2+ and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8703770 |
| Molecular Formula | C22H34N3O2+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCOc1ccccc1N1CC[NH+](CC(=O)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-2-27-21-11-7-6-10-20(21)25-16-14-24(15-17-25)18-22(26)23-13-12-19-8-4-3-5-9-19/h6-8,10-11H,2-5,9,12-18H2,1H3,(H,23,26)/p+1 |
| InChIKey | JVWYKWMXTFQVET-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|