C14H23N4O2+ — CID 7060420
2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetohydrazide (PubChem CID 7060420) has the molecular formula C14H23N4O2+ and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetohydrazide.
| Compound Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 7060420 |
| Molecular Formula | C14H23N4O2+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]acetohydrazide |
| SMILES | CCOc1ccccc1N1CC[NH+](CC(=O)NN)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-20-13-6-4-3-5-12(13)18-9-7-17(8-10-18)11-14(19)16-15/h3-6H,2,7-11,15H2,1H3,(H,16,19)/p+1 |
| InChIKey | WGPQKHCWNCNAFS-UHFFFAOYSA-O |
| XLogP | -1.22 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|