C22H30N3O2S+ — CID 9027893
2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 9027893) has the molecular formula C22H30N3O2S+ and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 9027893 |
| Molecular Formula | C22H30N3O2S+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | CCOc1ccccc1N1CC[NH+](CC(=O)NCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-2-27-21-11-7-6-10-20(21)25-15-13-24(14-16-25)18-22(26)23-12-17-28-19-8-4-3-5-9-19/h3-11H,2,12-18H2,1H3,(H,23,26)/p+1 |
| InChIKey | LNDHQXBUWBEJKA-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|