C22H32N4O3 — CID 8687337
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 8687337) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8687337 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccccc1N1CCN(CC(=O)NC(=O)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C22H32N4O3/c1-29-20-10-6-5-9-19(20)26-15-13-25(14-16-26)17-21(27)24-22(28)23-12-11-18-7-3-2-4-8-18/h5-7,9-10H,2-4,8,11-17H2,1H3,(H2,23,24,27,28) |
| InChIKey | JUDAIZIUEBRJSR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|