C22H38N4O2+2 — CID 8917672
2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-hexylacetamide (PubChem CID 8917672) has the molecular formula C22H38N4O2+2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-hexylacetamide.
| Compound Name | 2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-hexylacetamide |
|---|---|
| PubChem CID | 8917672 |
| Molecular Formula | C22H38N4O2+2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)C[NH+]1CC[NH+](CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C22H36N4O2/c1-4-5-6-7-11-23-20(27)16-25-12-14-26(15-13-25)17-21(28)24-22-18(2)9-8-10-19(22)3/h8-10H,4-7,11-17H2,1-3H3,(H,23,27)(H,24,28)/p+2 |
| InChIKey | ITGVYQJXOBVCNM-UHFFFAOYSA-P |
| XLogP | -0.28 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|