C23H34N4O3+2 — CID 8756335
[2-[4-[2-(butylamino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8756335) has the molecular formula C23H34N4O3+2 and a molecular weight of 414.55 g/mol. Its IUPAC name is [2-[4-[2-(butylamino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-[4-[2-(butylamino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8756335 |
| Molecular Formula | C23H34N4O3+2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [2-[4-[2-(butylamino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | CCCCNC(=O)C[NH+]1CCN(C(=O)C[NH2+][C@H](c2ccccc2)c2ccco2)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-2-3-11-24-21(28)18-26-12-14-27(15-13-26)22(29)17-25-23(20-10-7-16-30-20)19-8-5-4-6-9-19/h4-10,16,23,25H,2-3,11-15,17-18H2,1H3,(H,24,28)/p+2/t23-/m1/s1 |
| InChIKey | GGAUBCIDLLQNNN-HSZRJFAPSA-P |
| XLogP | -0.42 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|