C16H18N3O3+ — CID 8755765
[(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium (PubChem CID 8755765) has the molecular formula C16H18N3O3+ and a molecular weight of 300.34 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8755765 |
| Molecular Formula | C16H18N3O3+ |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1ccco1)N1CCNC1=O |
| InChI | InChI=1S/C16H17N3O3/c20-14(19-9-8-17-16(19)21)11-18-15(13-7-4-10-22-13)12-5-2-1-3-6-12/h1-7,10,15,18H,8-9,11H2,(H,17,21)/p+1/t15-/m1/s1 |
| InChIKey | JUWLOIVEVBUYRQ-OAHLLOKOSA-O |
| XLogP | 0.48 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |