C21H25N4O2+ — CID 8755833
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755833) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755833 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@@H](c1ccccc1)c1ccco1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C21H24N4O2/c26-20(24-19-12-13-23-25(19)17-9-4-5-10-17)15-22-21(18-11-6-14-27-18)16-7-2-1-3-8-16/h1-3,6-8,11-14,17,21-22H,4-5,9-10,15H2,(H,24,26)/p+1/t21-/m0/s1 |
| InChIKey | NHUZLXOHWATCAJ-NRFANRHFSA-O |
| XLogP | 2.88 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |