C19H17Cl2N2O2+ — CID 8696127
[2-(2,6-dichloroanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8696127) has the molecular formula C19H17Cl2N2O2+ and a molecular weight of 376.26 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8696127 |
| Molecular Formula | C19H17Cl2N2O2+ |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1ccco1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-14-8-4-9-15(21)19(14)23-17(24)12-22-18(16-10-5-11-25-16)13-6-2-1-3-7-13/h1-11,18,22H,12H2,(H,23,24)/p+1/t18-/m1/s1 |
| InChIKey | WQMJAWOHFHKTTD-GOSISDBHSA-O |
| XLogP | 3.88 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |