C20H21N2O2S+ — CID 8696199
[(R)-furan-2-yl(phenyl)methyl]-[2-(3-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 8696199) has the molecular formula C20H21N2O2S+ and a molecular weight of 353.47 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-(3-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-(3-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8696199 |
| Molecular Formula | C20H21N2O2S+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-(3-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | CSc1cccc(NC(=O)C[NH2+][C@H](c2ccccc2)c2ccco2)c1 |
| InChI | InChI=1S/C20H20N2O2S/c1-25-17-10-5-9-16(13-17)22-19(23)14-21-20(18-11-6-12-24-18)15-7-3-2-4-8-15/h2-13,20-21H,14H2,1H3,(H,22,23)/p+1/t20-/m1/s1 |
| InChIKey | PUCYTSRQBRVSCF-HXUWFJFHSA-O |
| XLogP | 3.29 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |