C21H23N2O4+ — CID 8695957
[2-(2,5-dimethoxyanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8695957) has the molecular formula C21H23N2O4+ and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8695957 |
| Molecular Formula | C21H23N2O4+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | COc1ccc(OC)c(NC(=O)C[NH2+][C@H](c2ccccc2)c2ccco2)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-25-16-10-11-18(26-2)17(13-16)23-20(24)14-22-21(19-9-6-12-27-19)15-7-4-3-5-8-15/h3-13,21-22H,14H2,1-2H3,(H,23,24)/p+1/t21-/m1/s1 |
| InChIKey | CAEJGHLZNCILBA-OAQYLSRUSA-O |
| XLogP | 2.59 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |