C22H22ClN2O2+ — CID 7999776
benzhydryl-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 7999776) has the molecular formula C22H22ClN2O2+ and a molecular weight of 381.88 g/mol. Its IUPAC name is benzhydryl-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7999776 |
| Molecular Formula | C22H22ClN2O2+ |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | benzhydryl-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+]C(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O2/c1-27-20-13-12-18(14-19(20)23)25-21(26)15-24-22(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,22,24H,15H2,1H3,(H,25,26)/p+1 |
| InChIKey | RLMQKDXUHVOHKL-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |