C25H23N2O2+ — CID 8755105
[(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 8755105) has the molecular formula C25H23N2O2+ and a molecular weight of 383.47 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8755105 |
| Molecular Formula | C25H23N2O2+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1ccco1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2/c28-24(27-22-15-8-7-14-21(22)19-10-3-1-4-11-19)18-26-25(23-16-9-17-29-23)20-12-5-2-6-13-20/h1-17,25-26H,18H2,(H,27,28)/p+1/t25-/m1/s1 |
| InChIKey | DDWBEIDGOPAEPT-RUZDIDTESA-O |
| XLogP | 4.24 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |