C20H19F2N2O2S+ — CID 8756043
[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8756043) has the molecular formula C20H19F2N2O2S+ and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8756043 |
| Molecular Formula | C20H19F2N2O2S+ |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@@H](c1ccccc1)c1ccco1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C20H18F2N2O2S/c21-20(22)27-17-11-5-4-9-15(17)24-18(25)13-23-19(16-10-6-12-26-16)14-7-2-1-3-8-14/h1-12,19-20,23H,13H2,(H,24,25)/p+1/t19-/m0/s1 |
| InChIKey | VUQCISIEBFWOFV-IBGZPJMESA-O |
| XLogP | 3.89 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |