C16H22N4O2 — CID 8920834
N-(2-cyclopentylpyrazol-3-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide (PubChem CID 8920834) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8920834 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccnn1C1CCCC1)c1ccco1 |
| InChI | InChI=1S/C16H22N4O2/c1-12(14-7-4-10-22-14)17-11-16(21)19-15-8-9-18-20(15)13-5-2-3-6-13/h4,7-10,12-13,17H,2-3,5-6,11H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | VDVOUPYHTPSBJD-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |