C21H24N4OS — CID 17462248
N-(2-cyclopentylpyrazol-3-yl)-2-[[phenyl(thiophen-2-yl)methyl]amino]acetamide (PubChem CID 17462248) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-2-[[phenyl(thiophen-2-yl)methyl]amino]acetamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-2-[[phenyl(thiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 17462248 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-2-[[phenyl(thiophen-2-yl)methyl]amino]acetamide |
| SMILES | O=C(CNC(c1ccccc1)c1cccs1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C21H24N4OS/c26-20(24-19-12-13-23-25(19)17-9-4-5-10-17)15-22-21(18-11-6-14-27-18)16-7-2-1-3-8-16/h1-3,6-8,11-14,17,21-22H,4-5,9-10,15H2,(H,24,26) |
| InChIKey | VGBICOQAWBPTAC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |