C19H23N5OS — CID 46994696
N-(2-cyclohexylpyrazol-3-yl)-2-(4-methyl-3-thiophen-2-ylpyrazol-1-yl)acetamide (PubChem CID 46994696) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-2-(4-methyl-3-thiophen-2-ylpyrazol-1-yl)acetamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-2-(4-methyl-3-thiophen-2-ylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 46994696 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-2-(4-methyl-3-thiophen-2-ylpyrazol-1-yl)acetamide |
| SMILES | Cc1cn(CC(=O)Nc2ccnn2C2CCCCC2)nc1-c1cccs1 |
| InChI | InChI=1S/C19H23N5OS/c1-14-12-23(22-19(14)16-8-5-11-26-16)13-18(25)21-17-9-10-20-24(17)15-6-3-2-4-7-15/h5,8-12,15H,2-4,6-7,13H2,1H3,(H,21,25) |
| InChIKey | FMEXTXPRWDQSCQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |